CAS 69716-05-8 appears in our catalog under these names: 2-(6-Methoxy-1-benzofuran-3-yl)acetic acid, 95%, 2–(6–Methoxybenzofuran–3–yl)acetic acid, 2-(6-Methoxy-1-benzofuran-3-yl)acetic acid, 97% , 2-(6-Methoxybenzofuran-3-yl)acetic acid 97%, 2-(6-Methoxybenzofuran-3-yl)acetic acid, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 10g, 5g.
2-(6-methoxy-1-benzofuran-3-yl)acetic acid (CAS 69716-05-8) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 2-(6-methoxy-1-benzofuran-3-yl)acetic acid. InChIKey: QCXJFLREQGIACT-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 2-(6-methoxy-1-benzofuran-3-yl)acetic acid |
| InChIKey | QCXJFLREQGIACT-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CO2)CC(=O)O |
Computed by PubChem (NCBI)