CAS 14939-91-4 appears in our catalog under these names: 3-(2,3-Dihydro-1,4-benzodioxin-6-yl)acrylic acid, 95%, 3-(2,3-Dihydrobenzo(b)(1,4)dioxin-6-yl)acrylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg.
(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoic acid (CAS 14939-91-4) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoic acid. InChIKey: KPDOZWMLNDDCDJ-DUXPYHPUSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoic acid |
| InChIKey | KPDOZWMLNDDCDJ-DUXPYHPUSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)