cas: 808740-52-5 — see every product listed under this CAS number, including other names
3-(2-Fluoro-phenyl)-isoxazole-5-carbaldehyde, 97%, 97% (CAS 808740-52-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119LMO-100mg |
| cas | 808740-52-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 2142.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(2-fluorophenyl)-1,2-oxazole-5-carbaldehyde (CAS 808740-52-5) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 3-(2-fluorophenyl)-1,2-oxazole-5-carbaldehyde. InChIKey: XKEKTJAIKFOVIQ-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 3-(2-fluorophenyl)-1,2-oxazole-5-carbaldehyde |
| InChIKey | XKEKTJAIKFOVIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=C2)C=O)F |
Computed by PubChem (NCBI)