cas: 808740-52-5 — see every product listed under this CAS number, including other names
3-(2-Fluorophenyl)isoxazole-5-carbaldehyde 97% (CAS 808740-52-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A481130-5g |
| cas | 808740-52-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 6249.94 Pln | |
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 843.19 Pln | |
| Ambeed | 1g | 1616.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A481130 |
3-(2-fluorophenyl)-1,2-oxazole-5-carbaldehyde (CAS 808740-52-5) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 3-(2-fluorophenyl)-1,2-oxazole-5-carbaldehyde. InChIKey: XKEKTJAIKFOVIQ-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 3-(2-fluorophenyl)-1,2-oxazole-5-carbaldehyde |
| InChIKey | XKEKTJAIKFOVIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=C2)C=O)F |
Computed by PubChem (NCBI)