cas: 109089-77-2 — see every product listed under this CAS number, including other names
3-(2-Methoxy-5-methyl-phenyl)-3-phenyl-propionic acid (CAS 109089-77-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036590-1G |
| cas | 109089-77-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 440.49 Pln | |
| Fluorochem | 25g | 1528.65 Pln |
| delivery time | 3-4 weeks |
|---|
3-(2-methoxy-5-methylphenyl)-3-phenylpropanoic acid (CAS 109089-77-2) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoic acid. InChIKey: KSLPLDLDQANKOD-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoic acid |
| InChIKey | KSLPLDLDQANKOD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)C(CC(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)