CAS 70757-61-8 appears in our catalog under these names: [4-(1-Methyl-1-phenylethyl)phenoxy]acetic acid, 95%, (4-(1-Methyl-1-phenylethyl)phenoxy)acetic acid, [4-(1-Methyl-1-phenylethyl)phenoxy]acetic acid, 95%, 95%, 2-(4-(2-Phenylpropan-2-yl)phenoxy)acetic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 1000mg, 2000mg, 5000mg, 10000mg, 250mg.
2-[4-(2-phenylpropan-2-yl)phenoxy]acetic acid (CAS 70757-61-8) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 2-[4-(2-phenylpropan-2-yl)phenoxy]acetic acid. InChIKey: FHCJMUZSWRNFNA-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 2-[4-(2-phenylpropan-2-yl)phenoxy]acetic acid |
| InChIKey | FHCJMUZSWRNFNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)