Products 2432848-59-2

CAS 2432848-59-2 is the registry number for Methyl 2-(benzyloxy)-4,5-dimethylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 4,5-dimethyl-2-phenylmethoxybenzoate (CAS 2432848-59-2) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: methyl 4,5-dimethyl-2-phenylmethoxybenzoate. InChIKey: XUGKCCJKRJZYIL-UHFFFAOYSA-N.

Identity
Molecular formulaC17H18O3
Molecular weight270.32 g/mol
IUPAC namemethyl 4,5-dimethyl-2-phenylmethoxybenzoate
InChIKeyXUGKCCJKRJZYIL-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C)OCC2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)