CAS 109089-77-2 appears in our catalog under these names: 3–(2–Methoxy–5–methylphenyl)–3–phenylpropionic Acid, 3-(2-Methoxy-5-methylphenyl)-3-phenylpropanoic acid, 98%, 3-(2-Methoxy-5-methylphenyl)-3-phenyl-propanoic Acid, >95% (HPLC), 3-(2-Methoxy-5-methylphenyl)-3-phenylpropanoic acid, 98%+(LC-MS),RG, 98%+(LC-MS),RG, 3-(2-Methoxy-5-methyl-phenyl)-3-phenyl-propionic acid, 98%+(LC-MS),RG. Offered by: GLPBio, Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 2g, 500mg.
3-(2-methoxy-5-methylphenyl)-3-phenylpropanoic acid (CAS 109089-77-2) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoic acid. InChIKey: KSLPLDLDQANKOD-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoic acid |
| InChIKey | KSLPLDLDQANKOD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)C(CC(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)