Products 875927-49-4
CAS 875927-49-4 appears in our catalog under these names: 4-Isobutoxybiphenyl-4'-carboxylic acid, 4-Isobutoxybiphenyl-4'-carboxylic acid, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
4-[4-(2-methylpropoxy)phenyl]benzoic acid (CAS 875927-49-4) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 4-[4-(2-methylpropoxy)phenyl]benzoic acid. InChIKey: CEIXAQTZSWOQDL-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 4-[4-(2-methylpropoxy)phenyl]benzoic acid |
| InChIKey | CEIXAQTZSWOQDL-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)