cas: 93041-44-2 — see every product listed under this CAS number, including other names
3-(2-Methoxyphenyl)-5-methylisoxazole-4-carboxylic acid, 95+% (CAS 93041-44-2) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A932010-10g |
| cas | 93041-44-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6417.25 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 93041-44-2) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: KOQSJBSGCNLIJY-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 3-(2-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | KOQSJBSGCNLIJY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2OC)C(=O)O |
Computed by PubChem (NCBI)