3-(2-Naphthyl)propanoic Acid, 97%
cas: 21658-35-5 — see every product listed under this CAS number, including other names
3-(2-Naphthyl)propanoic Acid, 97% (CAS 21658-35-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 50g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A837578-250mg |
| cas | 21658-35-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 537.25 Pln | |
| Ambeed | 25g | 1761.00 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 25g | 1648.40 Pln | |
| Chemat | 50g | 2474.00 Pln | |
| Chemat | 100g | 4542.80 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 569.82 Pln | |
| BLDpharm | 25g | 1897.13 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-naphthalen-2-ylpropanoic acid (CAS 21658-35-5) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 3-naphthalen-2-ylpropanoic acid. InChIKey: IZOYTDIICIICBE-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 3-naphthalen-2-ylpropanoic acid |
| InChIKey | IZOYTDIICIICBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(naphthalen-2-yl)propanoic acid, 3-(2-naphthyl)propanoic acid, 3-naphthalen-2-ylpropanoic acid, 2-naphthalenepropanoic acid, 2-Naphthalenepropionic acid, 3-Naphthalen-2-yl-propionicacid, 3-(2-naphthalenyl)propanoic acid, 2-naphthyl-3-propa, 2-naphthyl-3-propanoic acid, 3-(2-naphthyl)propanoicacid