3-(2-Pyridyl)aniline, 96%
cas: 15889-32-4 — see every product listed under this CAS number, including other names
3-(2-Pyridyl)aniline, 96% (CAS 15889-32-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A694366-100mg |
| cas | 15889-32-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1471.75 Pln | |
| Ambeed | 25g | 6060.81 Pln | |
| BLDpharm | 100mg | 264.38 Pln | |
| BLDpharm | 250mg | 308.80 Pln | |
| BLDpharm | 1g | 375.45 Pln | |
| BLDpharm | 5g | 1580.58 Pln | |
| BLDpharm | 25g | 5940.16 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
3-pyridin-2-ylaniline (CAS 15889-32-4) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 3-pyridin-2-ylaniline. InChIKey: YLNMGMIEOWFPRX-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 3-pyridin-2-ylaniline |
| InChIKey | YLNMGMIEOWFPRX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)