CAS 15889-32-4 appears in our catalog under these names: 3-(2-Pyridyl)aniline, 97%, 2-(3-Aminophenyl) Pyridine, 3–(2–Pyridyl)aniline, 3-(2-Pyridyl)aniline 96%, 2-(3-Aminophenyl)pyridine, 97%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, on request, 100mg, 25g.
3-pyridin-2-ylaniline (CAS 15889-32-4) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 3-pyridin-2-ylaniline. InChIKey: YLNMGMIEOWFPRX-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 3-pyridin-2-ylaniline |
| InChIKey | YLNMGMIEOWFPRX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)