3-(3-Aminophenyl)piperidine-2,6-dione, 95%
cas: 1512414-62-8 — see every product listed under this CAS number, including other names
3-(3-Aminophenyl)piperidine-2,6-dione, 95% (CAS 1512414-62-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1550863-250mg |
| cas | 1512414-62-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1210.31 Pln | |
| Ambeed | 1g | 3318.50 Pln | |
| Ambeed | 5g | 8452.69 Pln | |
| Ambeed | 10g | 13486.75 Pln | |
| BLDpharm | 100mg | 814.18 Pln | |
| BLDpharm | 250mg | 1302.90 Pln | |
| BLDpharm | 1g | 3574.32 Pln | |
| BLDpharm | 5g | 9105.71 Pln | |
| BLDpharm | 10g | 14537.13 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-(3-aminophenyl)piperidine-2,6-dione (CAS 1512414-62-8) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 3-(3-aminophenyl)piperidine-2,6-dione. InChIKey: WASRWSKUJBTVIY-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 3-(3-aminophenyl)piperidine-2,6-dione |
| InChIKey | WASRWSKUJBTVIY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)
