Products 1512414-62-8
CAS 1512414-62-8 appears in our catalog under these names: 3-(3-Aminophenyl)-2,6-piperidinedione, 95%, 95%, CRBN ligand-882, 95.0%, 3-(3-Aminophenyl)piperidine-2,6-dione, 98%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25 mg, 50 mg, 250 mg.
3-(3-aminophenyl)piperidine-2,6-dione (CAS 1512414-62-8) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 3-(3-aminophenyl)piperidine-2,6-dione. InChIKey: WASRWSKUJBTVIY-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 3-(3-aminophenyl)piperidine-2,6-dione |
| InChIKey | WASRWSKUJBTVIY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)