cas: 260246-17-1 — see every product listed under this CAS number, including other names
3-(3-Fluoro-phenyl)-3-oxo-propionic acid methyl ester (CAS 260246-17-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014788-500MG |
| cas | 260246-17-1 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 778.91 Pln | |
| Fluorochem | 1g | 1143.37 Pln | |
| Fluorochem | 5g | 3163.49 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-(3-fluorophenyl)-3-oxopropanoate (CAS 260246-17-1) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: methyl 3-(3-fluorophenyl)-3-oxopropanoate. InChIKey: SMVCLVGDGBKTMN-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | methyl 3-(3-fluorophenyl)-3-oxopropanoate |
| InChIKey | SMVCLVGDGBKTMN-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)C1=CC(=CC=C1)F |
Computed by PubChem (NCBI)