CAS 1806331-01-0 is the registry number for Ethyl 4-fluoro-3-formylbenzoate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
Ethyl 4-fluoro-3-formylbenzoate (CAS 1806331-01-0) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: ethyl 4-fluoro-3-formylbenzoate. InChIKey: ARLNUOIGWWIBBW-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | ethyl 4-fluoro-3-formylbenzoate |
| InChIKey | ARLNUOIGWWIBBW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)F)C=O |
Computed by PubChem (NCBI)