Products 696589-22-7

CAS 696589-22-7 is the registry number for 2-Fluoro-4-methoxycinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 25g, 250mg.

Structural formula: {0} (CAS {1})

(E)-3-(2-fluoro-4-methoxyphenyl)prop-2-enoic acid (CAS 696589-22-7) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: (E)-3-(2-fluoro-4-methoxyphenyl)prop-2-enoic acid. InChIKey: KDSPBZWHHBVYFN-HWKANZROSA-N.

Identity
Molecular formulaC10H9FO3
Molecular weight196.17 g/mol
IUPAC name(E)-3-(2-fluoro-4-methoxyphenyl)prop-2-enoic acid
InChIKeyKDSPBZWHHBVYFN-HWKANZROSA-N
SMILESCOC1=CC(=C(C=C1)/C=C/C(=O)O)F

Computed by PubChem (NCBI)