CAS 260246-17-1 appears in our catalog under these names: Methyl 3-fluorobenzoylacetate, 95%, Methyl 3-fluorobenzoylacetate, 98%, 3-(3-Fluoro-phenyl)-3-oxo-propionic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 10g.
Methyl 3-(3-fluorophenyl)-3-oxopropanoate (CAS 260246-17-1) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: methyl 3-(3-fluorophenyl)-3-oxopropanoate. InChIKey: SMVCLVGDGBKTMN-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | methyl 3-(3-fluorophenyl)-3-oxopropanoate |
| InChIKey | SMVCLVGDGBKTMN-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)C1=CC(=CC=C1)F |
Computed by PubChem (NCBI)