Products 1943701-17-4
CAS 1943701-17-4 appears in our catalog under these names: 2-Oxopropyl 4-fluorobenzoate, 95%, 2-Oxopropyl 4-fluorobenzoate, 98%, 2-Oxopropyl 4-fluorobenzoate, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2-oxopropyl 4-fluorobenzoate (CAS 1943701-17-4) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: 2-oxopropyl 4-fluorobenzoate. InChIKey: GXBMYMUUGMAKKS-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 2-oxopropyl 4-fluorobenzoate |
| InChIKey | GXBMYMUUGMAKKS-UHFFFAOYSA-N |
| SMILES | CC(=O)COC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)