cas: 7152-04-7 — see every product listed under this CAS number, including other names
3-(4-Acetamidophenyl)acrylic acid, 95% (CAS 7152-04-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A813023-250mg |
| cas | 7152-04-7 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 512.68 Pln | |
| AmBeed | 1g | 955.36 Pln | |
| AmBeed | 25g | 4008.55 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(E)-3-(4-acetamidophenyl)prop-2-enoic acid (CAS 7152-04-7) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: (E)-3-(4-acetamidophenyl)prop-2-enoic acid. InChIKey: WGMFHSADKZJPGR-QPJJXVBHSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (E)-3-(4-acetamidophenyl)prop-2-enoic acid |
| InChIKey | WGMFHSADKZJPGR-QPJJXVBHSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)