cas: 7152-04-7 — see every product listed under this CAS number, including other names
3-(4-Acetamidophenyl)acrylic acid, 97%, 97% (CAS 7152-04-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KM0-1g |
| cas | 7152-04-7 |
| size | 1g |
| availability | 48g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 506.00 Pln | |
| Chemat | 10g | 808.40 Pln | |
| Chemat | 25g | 1552.40 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(E)-3-(4-acetamidophenyl)prop-2-enoic acid (CAS 7152-04-7) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: (E)-3-(4-acetamidophenyl)prop-2-enoic acid. InChIKey: WGMFHSADKZJPGR-QPJJXVBHSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (E)-3-(4-acetamidophenyl)prop-2-enoic acid |
| InChIKey | WGMFHSADKZJPGR-QPJJXVBHSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)