cas: 7152-04-7 — see every product listed under this CAS number, including other names
4-Acetamidocinnamic acid, 97% (CAS 7152-04-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F950937-5G |
| cas | 7152-04-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 664.37 Pln | |
| Fluorochem | 10g | 1075.68 Pln | |
| Fluorochem | 25g | 2101.36 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(E)-3-(4-acetamidophenyl)prop-2-enoic acid (CAS 7152-04-7) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: (E)-3-(4-acetamidophenyl)prop-2-enoic acid. InChIKey: WGMFHSADKZJPGR-QPJJXVBHSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (E)-3-(4-acetamidophenyl)prop-2-enoic acid |
| InChIKey | WGMFHSADKZJPGR-QPJJXVBHSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)