cas: 79611-55-5 — see every product listed under this CAS number, including other names
3-(4-Chlorophenyl)-1,1,1-trifluoro-2-propanone, 95%, 95% (CAS 79611-55-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11620N-100mg |
| cas | 79611-55-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 918.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-one (CAS 79611-55-5) is a chemical compound with the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-one. InChIKey: FKTNTKPCXIKFBJ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-one |
| InChIKey | FKTNTKPCXIKFBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)