cas: 682804-98-4 — see every product listed under this CAS number, including other names
3-(4-Fluoro-2-methoxyphenyl)acrylic acid, 95% (CAS 682804-98-4) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A325423-5g |
| cas | 682804-98-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 2927.89 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(E)-3-(4-fluoro-2-methoxyphenyl)prop-2-enoic acid (CAS 682804-98-4) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: (E)-3-(4-fluoro-2-methoxyphenyl)prop-2-enoic acid. InChIKey: CBAPVFYKWHSEKG-HWKANZROSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | (E)-3-(4-fluoro-2-methoxyphenyl)prop-2-enoic acid |
| InChIKey | CBAPVFYKWHSEKG-HWKANZROSA-N |
| SMILES | COC1=C(C=CC(=C1)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)