3-(4-Fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine, 95%
cas: 1082472-01-2 — see every product listed under this CAS number, including other names
3-(4-Fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine, 95% (CAS 1082472-01-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A229423-100mg |
| cas | 1082472-01-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 965.56 Pln | |
| Ambeed | 1g | 2478.56 Pln | |
| Chemat | 100mg | 568.40 Pln | |
| Chemat | 250mg | 971.60 Pln | |
| Chemat | 1g | 2512.40 Pln | |
| BLDpharm | 100mg | 597.59 Pln | |
| BLDpharm | 250mg | 1019.67 Pln | |
| BLDpharm | 1g | 2613.55 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine (CAS 1082472-01-2) is a chemical compound with the molecular formula C12H9FN4 and a molecular weight of 228.22 g/mol. IUPAC name: 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine. InChIKey: XRPOEIOBLVKRFT-UHFFFAOYSA-N.
| Molecular formula | C12H9FN4 |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| InChIKey | XRPOEIOBLVKRFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C3N2C=C(C=C3)N)F |
Computed by PubChem (NCBI)