CAS 40620-62-0 appears in our catalog under these names: 3-(4-Fluorophenyl)-3-hydroxypropanoic acid, 3-(4-Fluorophenyl)-3-hydroxypropanoic acid, 95%, 95%, 3-(4-Fluorophenyl)-3-hydroxypropanoic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 250mg.
3-(4-fluorophenyl)-3-hydroxypropanoic acid (CAS 40620-62-0) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: 3-(4-fluorophenyl)-3-hydroxypropanoic acid. InChIKey: QLEUDHYLOHWMLQ-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-3-hydroxypropanoic acid |
| InChIKey | QLEUDHYLOHWMLQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)O)F |
Computed by PubChem (NCBI)