3-(4-Fluorophenyl)-N,N-dimethylacrylamide, 97%
cas: 1081556-24-2 — see every product listed under this CAS number, including other names
3-(4-Fluorophenyl)-N,N-dimethylacrylamide, 97% (CAS 1081556-24-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A862714-250mg |
| cas | 1081556-24-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 25g | 615.13 Pln | |
| Ambeed | 100g | 1805.50 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 25g | 534.80 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 231.05 Pln | |
| BLDpharm | 25g | 603.15 Pln | |
| BLDpharm | 100g | 1763.85 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(E)-3-(4-fluorophenyl)-N,N-dimethylprop-2-enamide (CAS 1081556-24-2) is a chemical compound with the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. IUPAC name: (E)-3-(4-fluorophenyl)-N,N-dimethylprop-2-enamide. InChIKey: KOJWKVLQXCILPY-VMPITWQZSA-N.
| Molecular formula | C11H12FNO |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | (E)-3-(4-fluorophenyl)-N,N-dimethylprop-2-enamide |
| InChIKey | KOJWKVLQXCILPY-VMPITWQZSA-N |
| SMILES | CN(C)C(=O)/C=C/C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)