CAS 395673-46-8 appears in our catalog under these names: 6-Fluoro-4,4-dimethyl-1,3-dihydroquinolin-2-one, 98%, 6-Fluoro-4,4-dimethyl-3,4-dihydroquinolin-2(1H)-one 98%, 6-Fluoro-4,4-dimethyl-3,4-dihydroquinolin-2(1H)-one, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g.
6-fluoro-4,4-dimethyl-1,3-dihydroquinolin-2-one (CAS 395673-46-8) is a chemical compound with the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. IUPAC name: 6-fluoro-4,4-dimethyl-1,3-dihydroquinolin-2-one. InChIKey: FKSFQJWXHXGGJM-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 6-fluoro-4,4-dimethyl-1,3-dihydroquinolin-2-one |
| InChIKey | FKSFQJWXHXGGJM-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)NC2=C1C=C(C=C2)F)C |
Computed by PubChem (NCBI)