Products 1081556-24-2
CAS 1081556-24-2 is the registry number for 3-(4-Fluorophenyl)-N,N-dimethylacrylamide, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
(E)-3-(4-fluorophenyl)-N,N-dimethylprop-2-enamide (CAS 1081556-24-2) is a chemical compound with the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. IUPAC name: (E)-3-(4-fluorophenyl)-N,N-dimethylprop-2-enamide. InChIKey: KOJWKVLQXCILPY-VMPITWQZSA-N.
| Molecular formula | C11H12FNO |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | (E)-3-(4-fluorophenyl)-N,N-dimethylprop-2-enamide |
| InChIKey | KOJWKVLQXCILPY-VMPITWQZSA-N |
| SMILES | CN(C)C(=O)/C=C/C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)