CAS 349644-07-1 appears in our catalog under these names: 1-(4-Fluorobenzoyl)pyrrolidine, 98%, (4-Fluorophenyl)(pyrrolidin-1-yl)methanone, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
(4-fluorophenyl)-pyrrolidin-1-ylmethanone (CAS 349644-07-1) is a chemical compound with the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. IUPAC name: (4-fluorophenyl)-pyrrolidin-1-ylmethanone. InChIKey: YAUUECFHRSHLAF-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | (4-fluorophenyl)-pyrrolidin-1-ylmethanone |
| InChIKey | YAUUECFHRSHLAF-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)