CAS 1242156-52-0 appears in our catalog under these names: 4-Cyclopropyl-2-fluoro-6-methylbenzamide, 95%, 4–Cyclopropyl–2–fluoro–6–methylbenzamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
4-cyclopropyl-2-fluoro-6-methylbenzamide (CAS 1242156-52-0) is a chemical compound with the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. IUPAC name: 4-cyclopropyl-2-fluoro-6-methylbenzamide. InChIKey: BCXWTGJFSUBFML-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 4-cyclopropyl-2-fluoro-6-methylbenzamide |
| InChIKey | BCXWTGJFSUBFML-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)N)F)C2CC2 |
Computed by PubChem (NCBI)