cas: 22027-50-5 — see every product listed under this CAS number, including other names
3-(4-Methoxyphenyl)-3-oxo-propionic acid methylester, 95% (CAS 22027-50-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014762-1G |
| cas | 22027-50-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 25g | 200.99 Pln | |
| Fluorochem | 100g | 638.33 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 3-(4-methoxyphenyl)-3-oxopropanoate (CAS 22027-50-5) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: methyl 3-(4-methoxyphenyl)-3-oxopropanoate. InChIKey: VXXOASOINNOPGR-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | methyl 3-(4-methoxyphenyl)-3-oxopropanoate |
| InChIKey | VXXOASOINNOPGR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)CC(=O)OC |
Computed by PubChem (NCBI)