CAS 33173-31-8 appears in our catalog under these names: (S)-2-Acetoxy-3-phenylpropanoic acid, 95%, (S)–2–Acetoxy–3–phenylpropanoic acid, (S)-2-Acetoxy-3-phenylpropanoic acid, 97%, 97%, (S)-2-Acetoxy-3-phenylpropanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2S)-2-acetyloxy-3-phenylpropanoic acid (CAS 33173-31-8) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (2S)-2-acetyloxy-3-phenylpropanoic acid. InChIKey: VLUWDAHVYCOUSR-JTQLQIEISA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (2S)-2-acetyloxy-3-phenylpropanoic acid |
| InChIKey | VLUWDAHVYCOUSR-JTQLQIEISA-N |
| SMILES | CC(=O)O[C@@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)