CAS 82078-97-5 is the registry number for methyl (2R)-2-(acetyloxy)-2-phenylacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2R)-2-acetyloxy-2-phenylacetate (CAS 82078-97-5) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: methyl (2R)-2-acetyloxy-2-phenylacetate. InChIKey: SFGOUECCROBXPW-SNVBAGLBSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | methyl (2R)-2-acetyloxy-2-phenylacetate |
| InChIKey | SFGOUECCROBXPW-SNVBAGLBSA-N |
| SMILES | CC(=O)O[C@H](C1=CC=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)