CAS 52787-20-9 appears in our catalog under these names: Benzeneacetic acid, 3-(methoxycarbonyl)-, methyl ester, 95%, Benzeneacetic acid, 3-(methoxycarbonyl)-, methyl ester, 98%, 98%, BENZENEACETIC ACID, 3-(METHOXYCARBONYL)-, METHYL ESTER, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
Methyl 3-(2-methoxy-2-oxoethyl)benzoate (CAS 52787-20-9) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: methyl 3-(2-methoxy-2-oxoethyl)benzoate. InChIKey: XYJVSCYQGXVUKN-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | methyl 3-(2-methoxy-2-oxoethyl)benzoate |
| InChIKey | XYJVSCYQGXVUKN-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)