CAS 7249-16-3 appears in our catalog under these names: 3-(4-Acetoxyphenyl)propanoic acid, 95%, 3-(4-Acetoxyphenyl)propanoic acid, 95%, 95%, Beta-(4-acetoxyphenyl)propionic acid, 95%, β-(4-Acetoxyphenyl)propionic acid. Offered by: Ambeed, Chemat, Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
3-(4'-acetoxyphenyl)propionic acid is a monocarboxylic acid that is propionic acid substituted by a 4'-acetoxyphenyl group at position 3. It is a monocarboxylic acid and an acetate ester.
Source: ChEBI
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 3-(4-acetyloxyphenyl)propanoic acid |
| InChIKey | YQPHNMWXZLUIJX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)CCC(=O)O |
Computed by PubChem (NCBI)