cas: 1197193-05-7 — see every product listed under this CAS number, including other names
3-(4-Methylpiperazin-1-yl)-4-(methylsulfonyl)benzoic acid (CAS 1197193-05-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446617-250MG |
| cas | 1197193-05-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 737.26 Pln | |
| Fluorochem | 1g | 1768.15 Pln | |
| Fluorochem | 5g | 5824.01 Pln |
| delivery time | 3-4 weeks |
|---|
3-(4-methylpiperazin-1-yl)-4-methylsulfonylbenzoic acid (CAS 1197193-05-7) is a chemical compound with the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. IUPAC name: 3-(4-methylpiperazin-1-yl)-4-methylsulfonylbenzoic acid. InChIKey: VZCBSTYAURPPKO-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | 3-(4-methylpiperazin-1-yl)-4-methylsulfonylbenzoic acid |
| InChIKey | VZCBSTYAURPPKO-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=CC(=C2)C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)