cas: 90610-69-8 — see every product listed under this CAS number, including other names
3-(4-Sulfamoyl-phenyl)-propionic acid, 95% (CAS 90610-69-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F059534-1G |
| cas | 90610-69-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 351.98 Pln | |
| Fluorochem | 10g | 643.54 Pln | |
| Fluorochem | 25g | 1278.73 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-(4-sulfamoylphenyl)propanoic acid (CAS 90610-69-8) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 3-(4-sulfamoylphenyl)propanoic acid. InChIKey: JUEONDBIBADVGD-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 3-(4-sulfamoylphenyl)propanoic acid |
| InChIKey | JUEONDBIBADVGD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)