cas: 3617-01-4 — see every product listed under this CAS number, including other names
3-(4-chlorophenyl)-2-hydroxyprop-2-enoic acid, 97% (CAS 3617-01-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F792127-100MG |
| cas | 3617-01-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 372.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(4-chlorophenyl)-2-oxopropanoic acid (CAS 3617-01-4) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: 3-(4-chlorophenyl)-2-oxopropanoic acid. InChIKey: VRYUGTMBOLOQTA-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2-oxopropanoic acid |
| InChIKey | VRYUGTMBOLOQTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)C(=O)O)Cl |
Computed by PubChem (NCBI)