3-(4-methoxyphenyl)isoxazol-5-amine, 95%
cas: 86685-98-5 — see every product listed under this CAS number, including other names
3-(4-methoxyphenyl)isoxazol-5-amine, 95% (CAS 86685-98-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F366608-250MG |
| cas | 86685-98-5 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 935.11 Pln | |
| Fluorochem | 5g | 1716.08 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 687.44 Pln | |
| Ambeed | 5g | 2233.81 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 563.60 Pln | |
| Chemat | 5g | 1034.00 Pln | |
| BLDpharm | 100mg | 231.05 Pln | |
| BLDpharm | 250mg | 308.80 Pln | |
| BLDpharm | 1g | 736.43 Pln | |
| BLDpharm | 5g | 2402.51 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
3-(4-methoxyphenyl)-1,2-oxazol-5-amine (CAS 86685-98-5) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 3-(4-methoxyphenyl)-1,2-oxazol-5-amine. InChIKey: PHOQFLXRNUDPHQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)-1,2-oxazol-5-amine |
| InChIKey | PHOQFLXRNUDPHQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=C2)N |
Computed by PubChem (NCBI)