3-(5-(Thiophen-2-yl)furan-2-yl)propanoic acid, 95%
cas: 24090-38-8 — see every product listed under this CAS number, including other names
3-(5-(Thiophen-2-yl)furan-2-yl)propanoic acid, 95% (CAS 24090-38-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A112601-250mg |
| cas | 24090-38-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 720.81 Pln | |
| Ambeed | 1g | 1816.62 Pln | |
| Ambeed | 5g | 6177.62 Pln | |
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1946.00 Pln | |
| BLDpharm | 100mg | 486.52 Pln | |
| BLDpharm | 250mg | 769.75 Pln | |
| BLDpharm | 1g | 1952.67 Pln | |
| BLDpharm | 5g | 6656.57 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-(5-thiophen-2-ylfuran-2-yl)propanoic acid (CAS 24090-38-8) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: 3-(5-thiophen-2-ylfuran-2-yl)propanoic acid. InChIKey: ADIPPCCQUCTDJD-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | 3-(5-thiophen-2-ylfuran-2-yl)propanoic acid |
| InChIKey | ADIPPCCQUCTDJD-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(O2)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(5-Thiophen-2-yl-furan-2-yl)-propionic acid, 3-[5-(2-thienyl)-2-furyl]propanoic acid, 3-(5-(Thiophen-2-yl)furan-2-yl)propanoic acid, 3-(5-thiophen-2-ylfuran-2-yl)propanoic acid, 3-[5-(thiophen-2-yl)furan-2-yl]propanoic acid, 3-(5-(2-thienyl)-2-furyl)propanoic acid, 2-furanpropanoic acid, 5-(2-thienyl)-, Cambridge id 6847944, 3-(5-thiophen-2-yl-furan-2-yl)propionic acid, TimTec1_006301