Products 65505-16-0
CAS 65505-16-0 appears in our catalog under these names: 2,5-Dimethyl-3-thiofuroylfuran, 95%, 2，5–Dimethyl–3–thiofuroylfuran, 3-Furancarbothioicacid, S-(2,5-dimethyl-3-furanyl) ester, 92%, 92%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
S-(2,5-dimethylfuran-3-yl) furan-3-carbothioate (CAS 65505-16-0) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: S-(2,5-dimethylfuran-3-yl) furan-3-carbothioate. InChIKey: QVKDTUVQQAKGEO-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | S-(2,5-dimethylfuran-3-yl) furan-3-carbothioate |
| InChIKey | QVKDTUVQQAKGEO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C)SC(=O)C2=COC=C2 |
Computed by PubChem (NCBI)
Synonyms:
S-(2,5-dimethylfuran-3-yl) furan-3-carbothioate, 3-Furancarbothioicacid, S-(2,5-dimethyl-3-furanyl) ester, FEMA No. 3481, S-(2,5-Dimethyl-3-furyl) thio-3-furoate, 3-Furancarbothioic acid, S-(2,5-dimethyl-3-furanyl) ester, S-(2,5-dimethyl-3-furyl) furan-3-carbothioate, QVKDTUVQQAKGEO-UHFFFAOYSA-N