CAS 23045-75-2 appears in our catalog under these names: 6-Methoxy-3-methylbenzo[b]thiophene-2-carboxylic acid, 95%, 6-Methoxy-3-methylbenzo(b)thiophene-2-carboxylic acid, 96%, 6-Methoxy-3-methylbenzo[b]thiophene-2-carboxylic acid, 96%, 96%, 6-Methoxy-3-methyl-benzo[b]thiophene-2-carboxylic acid, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg, 500mg.
6-methoxy-3-methyl-1-benzothiophene-2-carboxylic acid (CAS 23045-75-2) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: 6-methoxy-3-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: LMHFVTXBQQYWQO-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | 6-methoxy-3-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | LMHFVTXBQQYWQO-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=CC(=C2)OC)C(=O)O |
Computed by PubChem (NCBI)