CAS 550998-58-8 appears in our catalog under these names: 6-Methoxy-benzo[b]thiophene-2-carboxylic acid methyl ester, 95%, Methyl 6–methoxybenzo(b)thiophene–2–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 100mg.
Methyl 6-methoxy-1-benzothiophene-2-carboxylate (CAS 550998-58-8) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: methyl 6-methoxy-1-benzothiophene-2-carboxylate. InChIKey: VMGJIYVZMYUFSI-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | methyl 6-methoxy-1-benzothiophene-2-carboxylate |
| InChIKey | VMGJIYVZMYUFSI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(S2)C(=O)OC |
Computed by PubChem (NCBI)