Products 24090-38-8
CAS 24090-38-8 appears in our catalog under these names: 3-(5-Thiophen-2-yl-furan-2-yl)-propionic acid, 95%, 3-(5-(2-thienyl)-2-furyl)propanoic Acid, 3-(5-(Thiophen-2-yl)furan-2-yl)propanoic acid 95%, 3-(5-(Thiophen-2-yl)furan-2-yl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg, 5g.
3-(5-thiophen-2-ylfuran-2-yl)propanoic acid (CAS 24090-38-8) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: 3-(5-thiophen-2-ylfuran-2-yl)propanoic acid. InChIKey: ADIPPCCQUCTDJD-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | 3-(5-thiophen-2-ylfuran-2-yl)propanoic acid |
| InChIKey | ADIPPCCQUCTDJD-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(O2)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(5-Thiophen-2-yl-furan-2-yl)-propionic acid, 3-[5-(2-thienyl)-2-furyl]propanoic acid, 3-(5-(Thiophen-2-yl)furan-2-yl)propanoic acid, 3-(5-thiophen-2-ylfuran-2-yl)propanoic acid, 3-[5-(thiophen-2-yl)furan-2-yl]propanoic acid, 3-(5-(2-thienyl)-2-furyl)propanoic acid, 2-furanpropanoic acid, 5-(2-thienyl)-, Cambridge id 6847944, 3-(5-thiophen-2-yl-furan-2-yl)propionic acid, TimTec1_006301