cas: 20532-06-3 — see every product listed under this CAS number, including other names
3-(AMINOSULFONYL)-4-METHOXYBENZOIC ACID, 97%, 97% (CAS 20532-06-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113A1Q-100mg |
| cas | 20532-06-3 |
| size | 100mg |
| availability | 115g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 870.80 Pln | |
| Chemat | 250mg | 1062.80 Pln | |
| Chemat | 1g | 2781.20 Pln | |
| Chemat | 5g | 9573.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-methoxy-3-sulfamoylbenzoic acid (CAS 20532-06-3) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. IUPAC name: 4-methoxy-3-sulfamoylbenzoic acid. InChIKey: CKCJWLSXMXMIQO-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | 4-methoxy-3-sulfamoylbenzoic acid |
| InChIKey | CKCJWLSXMXMIQO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)