CAS 39628-94-9 appears in our catalog under these names: 4-Nitrobenzyl Mesylate, p–Nitrobenzyl mesylate, 4-Nitrobenzyl methanesulfonate, 97%, 97%, p-Nitrobenzyl mesylate, 98.78%, 4-Nitrobenzyl methanesulfonate, 97%. Offered by: TRC, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1mg, 5mg, 500μg, 250mg, 1g, 10 mg, 50 mg.
(4-nitrophenyl)methyl methanesulfonate (CAS 39628-94-9) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. IUPAC name: (4-nitrophenyl)methyl methanesulfonate. InChIKey: QZIYKAFPHRTIAI-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | (4-nitrophenyl)methyl methanesulfonate |
| InChIKey | QZIYKAFPHRTIAI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)