Products 1859739-90-4
CAS 1859739-90-4 is the registry number for 5-((1,1-Dioxidothietan-3-yl)amino)furan-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(1,1-dioxothietan-3-yl)amino]furan-2-carboxylic acid (CAS 1859739-90-4) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. IUPAC name: 5-[(1,1-dioxothietan-3-yl)amino]furan-2-carboxylic acid. InChIKey: IZAMDAINVNJGOU-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | 5-[(1,1-dioxothietan-3-yl)amino]furan-2-carboxylic acid |
| InChIKey | IZAMDAINVNJGOU-UHFFFAOYSA-N |
| SMILES | C1C(CS1(=O)=O)NC2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)