CAS 15481-55-7 is the registry number for ethyl 4-nitrobenzenesulfonate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
Ethyl 4-nitrobenzenesulfonate (CAS 15481-55-7) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. IUPAC name: ethyl 4-nitrobenzenesulfonate. InChIKey: MHGHMVLMYWTSMK-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | ethyl 4-nitrobenzenesulfonate |
| InChIKey | MHGHMVLMYWTSMK-UHFFFAOYSA-N |
| SMILES | CCOS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)